C25H30INO7 — CID 158487342
methyl 4-iodobenzoate;methyl 4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]benzoate (PubChem CID 158487342) has the molecular formula C25H30INO7 and a molecular weight of 583.42 g/mol. Its IUPAC name is methyl 4-iodobenzoate;methyl 4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]benzoate.
| Compound Name | methyl 4-iodobenzoate;methyl 4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]benzoate |
|---|---|
| PubChem CID | 158487342 |
| Molecular Formula | C25H30INO7 |
| Molecular Weight | 583.42 g/mol |
| Exact Mass | 583.11 |
| IUPAC Name | methyl 4-iodobenzoate;methyl 4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)CCCNC(=O)OC(C)(C)C)cc1.COC(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C17H23NO5.C8H7IO2/c1-17(2,3)23-16(21)18-11-5-6-14(19)12-7-9-13(10-8-12)15(20)22-4;1-11-8(10)6-2-4-7(9)5-3-6/h7-10H,5-6,11H2,1-4H3,(H,18,21);2-5H,1H3 |
| InChIKey | HIGJJWTZLHTUMN-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.42 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|