C18H14N4O3 — CID 174791748
[4-[6-amino-5-(pyridin-4-ylcarbamoyl)-3-pyridinyl]phenyl] formate (PubChem CID 174791748) has the molecular formula C18H14N4O3 and a molecular weight of 334.34 g/mol. Its IUPAC name is [4-[6-amino-5-(pyridin-4-ylcarbamoyl)-3-pyridinyl]phenyl] formate.
| Compound Name | [4-[6-amino-5-(pyridin-4-ylcarbamoyl)-3-pyridinyl]phenyl] formate |
|---|---|
| PubChem CID | 174791748 |
| Molecular Formula | C18H14N4O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | [4-[6-amino-5-(pyridin-4-ylcarbamoyl)-3-pyridinyl]phenyl] formate |
| SMILES | Nc1ncc(-c2ccc(OC=O)cc2)cc1C(=O)Nc1ccncc1 |
| InChI | InChI=1S/C18H14N4O3/c19-17-16(18(24)22-14-5-7-20-8-6-14)9-13(10-21-17)12-1-3-15(4-2-12)25-11-23/h1-11H,(H2,19,21)(H,20,22,24) |
| InChIKey | PBFNFLMCHNVHCY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|