C20H21N5O2S — CID 71061217
2-amino-5-[5-(morpholin-4-ylmethyl)thiophen-3-yl]-N-pyridin-4-ylpyridine-3-carboxamide (PubChem CID 71061217) has the molecular formula C20H21N5O2S and a molecular weight of 395.49 g/mol. Its IUPAC name is 2-amino-5-[5-(morpholin-4-ylmethyl)thiophen-3-yl]-N-pyridin-4-ylpyridine-3-carboxamide.
| Compound Name | 2-amino-5-[5-(morpholin-4-ylmethyl)thiophen-3-yl]-N-pyridin-4-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 71061217 |
| Molecular Formula | C20H21N5O2S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 2-amino-5-[5-(morpholin-4-ylmethyl)thiophen-3-yl]-N-pyridin-4-ylpyridine-3-carboxamide |
| SMILES | Nc1ncc(-c2csc(CN3CCOCC3)c2)cc1C(=O)Nc1ccncc1 |
| InChI | InChI=1S/C20H21N5O2S/c21-19-18(20(26)24-16-1-3-22-4-2-16)10-14(11-23-19)15-9-17(28-13-15)12-25-5-7-27-8-6-25/h1-4,9-11,13H,5-8,12H2,(H2,21,23)(H,22,24,26) |
| InChIKey | YXNUVQPEHUKSLS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |