C22H23N5O4 — CID 71061213
2-amino-5-[4-[bis(2-hydroxyethyl)carbamoyl]phenyl]-N-pyridin-4-ylpyridine-3-carboxamide (PubChem CID 71061213) has the molecular formula C22H23N5O4 and a molecular weight of 421.46 g/mol. Its IUPAC name is 2-amino-5-[4-[bis(2-hydroxyethyl)carbamoyl]phenyl]-N-pyridin-4-ylpyridine-3-carboxamide.
| Compound Name | 2-amino-5-[4-[bis(2-hydroxyethyl)carbamoyl]phenyl]-N-pyridin-4-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 71061213 |
| Molecular Formula | C22H23N5O4 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-amino-5-[4-[bis(2-hydroxyethyl)carbamoyl]phenyl]-N-pyridin-4-ylpyridine-3-carboxamide |
| SMILES | Nc1ncc(-c2ccc(C(=O)N(CCO)CCO)cc2)cc1C(=O)Nc1ccncc1 |
| InChI | InChI=1S/C22H23N5O4/c23-20-19(21(30)26-18-5-7-24-8-6-18)13-17(14-25-20)15-1-3-16(4-2-15)22(31)27(9-11-28)10-12-29/h1-8,13-14,28-29H,9-12H2,(H2,23,25)(H,24,26,30) |
| InChIKey | NHNOHNJHTZRPJD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 141.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |