C30H22N4O2 — CID 171423296
1-N,4-N-bis(4-pyridin-4-ylphenyl)benzene-1,4-dicarboxamide (PubChem CID 171423296) has the molecular formula C30H22N4O2 and a molecular weight of 470.53 g/mol. Its IUPAC name is 1-N,4-N-bis(4-pyridin-4-ylphenyl)benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis(4-pyridin-4-ylphenyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 171423296 |
| Molecular Formula | C30H22N4O2 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 1-N,4-N-bis(4-pyridin-4-ylphenyl)benzene-1,4-dicarboxamide |
| SMILES | O=C(Nc1ccc(-c2ccncc2)cc1)c1ccc(C(=O)Nc2ccc(-c3ccncc3)cc2)cc1 |
| InChI | InChI=1S/C30H22N4O2/c35-29(33-27-9-5-21(6-10-27)23-13-17-31-18-14-23)25-1-2-26(4-3-25)30(36)34-28-11-7-22(8-12-28)24-15-19-32-20-16-24/h1-20H,(H,33,35)(H,34,36) |
| InChIKey | SETRIKXRMYYAJE-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |