C23H25Cl2N3O — CID 118483954
N-[4-(2-amino-2-ethylcyclopropyl)phenyl]-4-pyridin-4-ylbenzamide;dihydrochloride (PubChem CID 118483954) has the molecular formula C23H25Cl2N3O and a molecular weight of 430.38 g/mol. Its IUPAC name is N-[4-(2-amino-2-ethylcyclopropyl)phenyl]-4-pyridin-4-ylbenzamide;dihydrochloride.
| Compound Name | N-[4-(2-amino-2-ethylcyclopropyl)phenyl]-4-pyridin-4-ylbenzamide;dihydrochloride |
|---|---|
| PubChem CID | 118483954 |
| Molecular Formula | C23H25Cl2N3O |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | N-[4-(2-amino-2-ethylcyclopropyl)phenyl]-4-pyridin-4-ylbenzamide;dihydrochloride |
| SMILES | CCC1(N)CC1c1ccc(NC(=O)c2ccc(-c3ccncc3)cc2)cc1.Cl.Cl |
| InChI | InChI=1S/C23H23N3O.2ClH/c1-2-23(24)15-21(23)18-7-9-20(10-8-18)26-22(27)19-5-3-16(4-6-19)17-11-13-25-14-12-17;;/h3-14,21H,2,15,24H2,1H3,(H,26,27);2*1H |
| InChIKey | PWTHFKRDBYPEPU-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |