C24H24N2O — CID 74763834
N-[4-[(1S,2R)-2-amino-2-ethylcyclopropyl]phenyl]-4-phenylbenzamide (PubChem CID 74763834) has the molecular formula C24H24N2O and a molecular weight of 356.47 g/mol. Its IUPAC name is N-[4-[(1S,2R)-2-amino-2-ethylcyclopropyl]phenyl]-4-phenylbenzamide.
| Compound Name | N-[4-[(1S,2R)-2-amino-2-ethylcyclopropyl]phenyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 74763834 |
| Molecular Formula | C24H24N2O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | N-[4-[(1S,2R)-2-amino-2-ethylcyclopropyl]phenyl]-4-phenylbenzamide |
| SMILES | CC[C@@]1(N)C[C@H]1c1ccc(NC(=O)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H24N2O/c1-2-24(25)16-22(24)19-12-14-21(15-13-19)26-23(27)20-10-8-18(9-11-20)17-6-4-3-5-7-17/h3-15,22H,2,16,25H2,1H3,(H,26,27)/t22-,24+/m0/s1 |
| InChIKey | XIOPFCHZQKJSGT-LADGPHEKSA-N |
| XLogP | 5.20 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |