C19H20N6O2S — CID 71061082
2-amino-5-[5-(morpholin-4-ylmethyl)thiophen-2-yl]-N-pyrimidin-4-ylpyridine-3-carboxamide (PubChem CID 71061082) has the molecular formula C19H20N6O2S and a molecular weight of 396.48 g/mol. Its IUPAC name is 2-amino-5-[5-(morpholin-4-ylmethyl)thiophen-2-yl]-N-pyrimidin-4-ylpyridine-3-carboxamide.
| Compound Name | 2-amino-5-[5-(morpholin-4-ylmethyl)thiophen-2-yl]-N-pyrimidin-4-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 71061082 |
| Molecular Formula | C19H20N6O2S |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 2-amino-5-[5-(morpholin-4-ylmethyl)thiophen-2-yl]-N-pyrimidin-4-ylpyridine-3-carboxamide |
| SMILES | Nc1ncc(-c2ccc(CN3CCOCC3)s2)cc1C(=O)Nc1ccncn1 |
| InChI | InChI=1S/C19H20N6O2S/c20-18-15(19(26)24-17-3-4-21-12-23-17)9-13(10-22-18)16-2-1-14(28-16)11-25-5-7-27-8-6-25/h1-4,9-10,12H,5-8,11H2,(H2,20,22)(H,21,23,24,26) |
| InChIKey | BSTMMSHLHCVWOV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |