C20H21N5OS — CID 39152618
(3-aminopyrazin-2-yl)-[4-[(5-phenylthiophen-2-yl)methyl]piperazin-1-yl]methanone (PubChem CID 39152618) has the molecular formula C20H21N5OS and a molecular weight of 379.49 g/mol. Its IUPAC name is (3-aminopyrazin-2-yl)-[4-[(5-phenylthiophen-2-yl)methyl]piperazin-1-yl]methanone.
| Compound Name | (3-aminopyrazin-2-yl)-[4-[(5-phenylthiophen-2-yl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 39152618 |
| Molecular Formula | C20H21N5OS |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (3-aminopyrazin-2-yl)-[4-[(5-phenylthiophen-2-yl)methyl]piperazin-1-yl]methanone |
| SMILES | Nc1nccnc1C(=O)N1CCN(Cc2ccc(-c3ccccc3)s2)CC1 |
| InChI | InChI=1S/C20H21N5OS/c21-19-18(22-8-9-23-19)20(26)25-12-10-24(11-13-25)14-16-6-7-17(27-16)15-4-2-1-3-5-15/h1-9H,10-14H2,(H2,21,23) |
| InChIKey | UNAJMGIJNXDSOY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |