C16H17ClFN5O — CID 39009137
(3-aminopyrazin-2-yl)-[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]methanone (PubChem CID 39009137) has the molecular formula C16H17ClFN5O and a molecular weight of 349.80 g/mol. Its IUPAC name is (3-aminopyrazin-2-yl)-[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | (3-aminopyrazin-2-yl)-[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 39009137 |
| Molecular Formula | C16H17ClFN5O |
| Molecular Weight | 349.80 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | (3-aminopyrazin-2-yl)-[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]methanone |
| SMILES | Nc1nccnc1C(=O)N1CCN(Cc2ccc(F)cc2Cl)CC1 |
| InChI | InChI=1S/C16H17ClFN5O/c17-13-9-12(18)2-1-11(13)10-22-5-7-23(8-6-22)16(24)14-15(19)21-4-3-20-14/h1-4,9H,5-8,10H2,(H2,19,21) |
| InChIKey | UUHUCVYTVHXWTK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.80 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |