C14H15ClFN5O — CID 56817573
[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-(2H-triazol-4-yl)methanone (PubChem CID 56817573) has the molecular formula C14H15ClFN5O and a molecular weight of 323.76 g/mol. Its IUPAC name is [4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-(2H-triazol-4-yl)methanone.
| Compound Name | [4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-(2H-triazol-4-yl)methanone |
|---|---|
| PubChem CID | 56817573 |
| Molecular Formula | C14H15ClFN5O |
| Molecular Weight | 323.76 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | [4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-(2H-triazol-4-yl)methanone |
| SMILES | O=C(c1cn[nH]n1)N1CCN(Cc2ccc(F)cc2Cl)CC1 |
| InChI | InChI=1S/C14H15ClFN5O/c15-12-7-11(16)2-1-10(12)9-20-3-5-21(6-4-20)14(22)13-8-17-19-18-13/h1-2,7-8H,3-6,9H2,(H,17,18,19) |
| InChIKey | DUBZRCZQQZJBSM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.76 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |