C15H14Cl2FN5O3 — CID 135747979
[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-(4-chloro-5-nitro-1H-pyrazol-3-yl)methanone (PubChem CID 135747979) has the molecular formula C15H14Cl2FN5O3 and a molecular weight of 402.21 g/mol. Its IUPAC name is [4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-(4-chloro-5-nitro-1H-pyrazol-3-yl)methanone.
| Compound Name | [4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-(4-chloro-5-nitro-1H-pyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 135747979 |
| Molecular Formula | C15H14Cl2FN5O3 |
| Molecular Weight | 402.21 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | [4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-(4-chloro-5-nitro-1H-pyrazol-3-yl)methanone |
| SMILES | O=C(c1n[nH]c([N+](=O)[O-])c1Cl)N1CCN(Cc2ccc(F)cc2Cl)CC1 |
| InChI | InChI=1S/C15H14Cl2FN5O3/c16-11-7-10(18)2-1-9(11)8-21-3-5-22(6-4-21)15(24)13-12(17)14(20-19-13)23(25)26/h1-2,7H,3-6,8H2,(H,19,20) |
| InChIKey | MWPGVNJADTXPOG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 95.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.21 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|