C23H21ClFN3O4S — CID 19501052
[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-[4-[(2-nitrophenoxy)methyl]thiophen-2-yl]methanone (PubChem CID 19501052) has the molecular formula C23H21ClFN3O4S and a molecular weight of 489.96 g/mol. Its IUPAC name is [4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-[4-[(2-nitrophenoxy)methyl]thiophen-2-yl]methanone.
| Compound Name | [4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-[4-[(2-nitrophenoxy)methyl]thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 19501052 |
| Molecular Formula | C23H21ClFN3O4S |
| Molecular Weight | 489.96 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | [4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-[4-[(2-nitrophenoxy)methyl]thiophen-2-yl]methanone |
| SMILES | O=C(c1cc(COc2ccccc2[N+](=O)[O-])cs1)N1CCN(Cc2ccc(F)cc2Cl)CC1 |
| InChI | InChI=1S/C23H21ClFN3O4S/c24-19-12-18(25)6-5-17(19)13-26-7-9-27(10-8-26)23(29)22-11-16(15-33-22)14-32-21-4-2-1-3-20(21)28(30)31/h1-6,11-12,15H,7-10,13-14H2 |
| InChIKey | YURGARVHMPIPCR-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.96 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|