C18H12F2N2O4S — CID 19501025
N-(2,5-difluorophenyl)-4-[(2-nitrophenoxy)methyl]thiophene-2-carboxamide (PubChem CID 19501025) has the molecular formula C18H12F2N2O4S and a molecular weight of 390.37 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-4-[(2-nitrophenoxy)methyl]thiophene-2-carboxamide.
| Compound Name | N-(2,5-difluorophenyl)-4-[(2-nitrophenoxy)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19501025 |
| Molecular Formula | C18H12F2N2O4S |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | N-(2,5-difluorophenyl)-4-[(2-nitrophenoxy)methyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1cc(F)ccc1F)c1cc(COc2ccccc2[N+](=O)[O-])cs1 |
| InChI | InChI=1S/C18H12F2N2O4S/c19-12-5-6-13(20)14(8-12)21-18(23)17-7-11(10-27-17)9-26-16-4-2-1-3-15(16)22(24)25/h1-8,10H,9H2,(H,21,23) |
| InChIKey | XKAFLILAROMVJH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|