C16H12F2N4O3S — CID 19496597
N-(2,5-difluorophenyl)-4-[(5-methyl-3-nitropyrazol-1-yl)methyl]thiophene-2-carboxamide (PubChem CID 19496597) has the molecular formula C16H12F2N4O3S and a molecular weight of 378.36 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-4-[(5-methyl-3-nitropyrazol-1-yl)methyl]thiophene-2-carboxamide.
| Compound Name | N-(2,5-difluorophenyl)-4-[(5-methyl-3-nitropyrazol-1-yl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19496597 |
| Molecular Formula | C16H12F2N4O3S |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | N-(2,5-difluorophenyl)-4-[(5-methyl-3-nitropyrazol-1-yl)methyl]thiophene-2-carboxamide |
| SMILES | Cc1cc([N+](=O)[O-])nn1Cc1csc(C(=O)Nc2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C16H12F2N4O3S/c1-9-4-15(22(24)25)20-21(9)7-10-5-14(26-8-10)16(23)19-13-6-11(17)2-3-12(13)18/h2-6,8H,7H2,1H3,(H,19,23) |
| InChIKey | SCPROTBQWQZBEA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|