C21H22FN5O3S — CID 19496642
[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-[4-[(5-methyl-3-nitropyrazol-1-yl)methyl]thiophen-2-yl]methanone (PubChem CID 19496642) has the molecular formula C21H22FN5O3S and a molecular weight of 443.50 g/mol. Its IUPAC name is [4-[(4-fluorophenyl)methyl]piperazin-1-yl]-[4-[(5-methyl-3-nitropyrazol-1-yl)methyl]thiophen-2-yl]methanone.
| Compound Name | [4-[(4-fluorophenyl)methyl]piperazin-1-yl]-[4-[(5-methyl-3-nitropyrazol-1-yl)methyl]thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 19496642 |
| Molecular Formula | C21H22FN5O3S |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | [4-[(4-fluorophenyl)methyl]piperazin-1-yl]-[4-[(5-methyl-3-nitropyrazol-1-yl)methyl]thiophen-2-yl]methanone |
| SMILES | Cc1cc([N+](=O)[O-])nn1Cc1csc(C(=O)N2CCN(Cc3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C21H22FN5O3S/c1-15-10-20(27(29)30)23-26(15)13-17-11-19(31-14-17)21(28)25-8-6-24(7-9-25)12-16-2-4-18(22)5-3-16/h2-5,10-11,14H,6-9,12-13H2,1H3 |
| InChIKey | KRAXUNRZEVBDGP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|