C20H19F2N5O3S — CID 19496711
[4-[(2,3-difluorophenyl)methyl]piperazin-1-yl]-[4-[(3-nitropyrazol-1-yl)methyl]thiophen-2-yl]methanone (PubChem CID 19496711) has the molecular formula C20H19F2N5O3S and a molecular weight of 447.47 g/mol. Its IUPAC name is [4-[(2,3-difluorophenyl)methyl]piperazin-1-yl]-[4-[(3-nitropyrazol-1-yl)methyl]thiophen-2-yl]methanone.
| Compound Name | [4-[(2,3-difluorophenyl)methyl]piperazin-1-yl]-[4-[(3-nitropyrazol-1-yl)methyl]thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 19496711 |
| Molecular Formula | C20H19F2N5O3S |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | [4-[(2,3-difluorophenyl)methyl]piperazin-1-yl]-[4-[(3-nitropyrazol-1-yl)methyl]thiophen-2-yl]methanone |
| SMILES | O=C(c1cc(Cn2ccc([N+](=O)[O-])n2)cs1)N1CCN(Cc2cccc(F)c2F)CC1 |
| InChI | InChI=1S/C20H19F2N5O3S/c21-16-3-1-2-15(19(16)22)12-24-6-8-25(9-7-24)20(28)17-10-14(13-31-17)11-26-5-4-18(23-26)27(29)30/h1-5,10,13H,6-9,11-12H2 |
| InChIKey | MWAYTHGNWYXIOV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|