C18H11ClF2N2O4S — CID 19469689
N-(4-chloro-2-nitrophenyl)-4-[(2,4-difluorophenoxy)methyl]thiophene-2-carboxamide (PubChem CID 19469689) has the molecular formula C18H11ClF2N2O4S and a molecular weight of 424.81 g/mol. Its IUPAC name is N-(4-chloro-2-nitrophenyl)-4-[(2,4-difluorophenoxy)methyl]thiophene-2-carboxamide.
| Compound Name | N-(4-chloro-2-nitrophenyl)-4-[(2,4-difluorophenoxy)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19469689 |
| Molecular Formula | C18H11ClF2N2O4S |
| Molecular Weight | 424.81 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | N-(4-chloro-2-nitrophenyl)-4-[(2,4-difluorophenoxy)methyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1[N+](=O)[O-])c1cc(COc2ccc(F)cc2F)cs1 |
| InChI | InChI=1S/C18H11ClF2N2O4S/c19-11-1-3-14(15(6-11)23(25)26)22-18(24)17-5-10(9-28-17)8-27-16-4-2-12(20)7-13(16)21/h1-7,9H,8H2,(H,22,24) |
| InChIKey | WFECLQPHECGMBX-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.81 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|