C12H8FNO5S — CID 19620593
4-[(4-fluoro-2-nitrophenoxy)methyl]thiophene-2-carboxylic acid (PubChem CID 19620593) has the molecular formula C12H8FNO5S and a molecular weight of 297.26 g/mol. Its IUPAC name is 4-[(4-fluoro-2-nitrophenoxy)methyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[(4-fluoro-2-nitrophenoxy)methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 19620593 |
| Molecular Formula | C12H8FNO5S |
| Molecular Weight | 297.26 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 4-[(4-fluoro-2-nitrophenoxy)methyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(COc2ccc(F)cc2[N+](=O)[O-])cs1 |
| InChI | InChI=1S/C12H8FNO5S/c13-8-1-2-10(9(4-8)14(17)18)19-5-7-3-11(12(15)16)20-6-7/h1-4,6H,5H2,(H,15,16) |
| InChIKey | MCJWZJQJWQBYLD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.26 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|