C18H12ClFN2O4S — CID 19495064
N-(2-chloro-5-nitrophenyl)-4-[(2-fluorophenoxy)methyl]thiophene-2-carboxamide (PubChem CID 19495064) has the molecular formula C18H12ClFN2O4S and a molecular weight of 406.82 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-4-[(2-fluorophenoxy)methyl]thiophene-2-carboxamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-4-[(2-fluorophenoxy)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19495064 |
| Molecular Formula | C18H12ClFN2O4S |
| Molecular Weight | 406.82 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-4-[(2-fluorophenoxy)methyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1cc([N+](=O)[O-])ccc1Cl)c1cc(COc2ccccc2F)cs1 |
| InChI | InChI=1S/C18H12ClFN2O4S/c19-13-6-5-12(22(24)25)8-15(13)21-18(23)17-7-11(10-27-17)9-26-16-4-2-1-3-14(16)20/h1-8,10H,9H2,(H,21,23) |
| InChIKey | MKOAZTMCXKKZPS-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.82 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|