C20H17ClN2O4S — CID 19488613
N-(2-chloro-5-nitrophenyl)-4-[(2,6-dimethylphenoxy)methyl]thiophene-2-carboxamide (PubChem CID 19488613) has the molecular formula C20H17ClN2O4S and a molecular weight of 416.89 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-4-[(2,6-dimethylphenoxy)methyl]thiophene-2-carboxamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-4-[(2,6-dimethylphenoxy)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19488613 |
| Molecular Formula | C20H17ClN2O4S |
| Molecular Weight | 416.89 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-4-[(2,6-dimethylphenoxy)methyl]thiophene-2-carboxamide |
| SMILES | Cc1cccc(C)c1OCc1csc(C(=O)Nc2cc([N+](=O)[O-])ccc2Cl)c1 |
| InChI | InChI=1S/C20H17ClN2O4S/c1-12-4-3-5-13(2)19(12)27-10-14-8-18(28-11-14)20(24)22-17-9-15(23(25)26)6-7-16(17)21/h3-9,11H,10H2,1-2H3,(H,22,24) |
| InChIKey | DLXOZEKKAOMHGN-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.89 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|