C21H20N2O5S — CID 19505427
4-[(3,5-dimethylphenoxy)methyl]-N-(2-methoxy-4-nitrophenyl)thiophene-2-carboxamide (PubChem CID 19505427) has the molecular formula C21H20N2O5S and a molecular weight of 412.47 g/mol. Its IUPAC name is 4-[(3,5-dimethylphenoxy)methyl]-N-(2-methoxy-4-nitrophenyl)thiophene-2-carboxamide.
| Compound Name | 4-[(3,5-dimethylphenoxy)methyl]-N-(2-methoxy-4-nitrophenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19505427 |
| Molecular Formula | C21H20N2O5S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 4-[(3,5-dimethylphenoxy)methyl]-N-(2-methoxy-4-nitrophenyl)thiophene-2-carboxamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)c1cc(COc2cc(C)cc(C)c2)cs1 |
| InChI | InChI=1S/C21H20N2O5S/c1-13-6-14(2)8-17(7-13)28-11-15-9-20(29-12-15)21(24)22-18-5-4-16(23(25)26)10-19(18)27-3/h4-10,12H,11H2,1-3H3,(H,22,24) |
| InChIKey | QCJPOZSLMBHFPB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|