C20H25N3O5 — CID 26429979
2-[2-(3,5-dimethylphenoxy)ethyl-methylamino]-N-(2-methoxy-4-nitrophenyl)acetamide (PubChem CID 26429979) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is 2-[2-(3,5-dimethylphenoxy)ethyl-methylamino]-N-(2-methoxy-4-nitrophenyl)acetamide.
| Compound Name | 2-[2-(3,5-dimethylphenoxy)ethyl-methylamino]-N-(2-methoxy-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 26429979 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 2-[2-(3,5-dimethylphenoxy)ethyl-methylamino]-N-(2-methoxy-4-nitrophenyl)acetamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)CN(C)CCOc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C20H25N3O5/c1-14-9-15(2)11-17(10-14)28-8-7-22(3)13-20(24)21-18-6-5-16(23(25)26)12-19(18)27-4/h5-6,9-12H,7-8,13H2,1-4H3,(H,21,24) |
| InChIKey | SHHGSOVKEIIRSW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|