C18H12Cl2N2O4S — CID 19505163
N-(2-chloro-4-nitrophenyl)-4-[(3-chlorophenoxy)methyl]thiophene-2-carboxamide (PubChem CID 19505163) has the molecular formula C18H12Cl2N2O4S and a molecular weight of 423.28 g/mol. Its IUPAC name is N-(2-chloro-4-nitrophenyl)-4-[(3-chlorophenoxy)methyl]thiophene-2-carboxamide.
| Compound Name | N-(2-chloro-4-nitrophenyl)-4-[(3-chlorophenoxy)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19505163 |
| Molecular Formula | C18H12Cl2N2O4S |
| Molecular Weight | 423.28 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | N-(2-chloro-4-nitrophenyl)-4-[(3-chlorophenoxy)methyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1Cl)c1cc(COc2cccc(Cl)c2)cs1 |
| InChI | InChI=1S/C18H12Cl2N2O4S/c19-12-2-1-3-14(7-12)26-9-11-6-17(27-10-11)18(23)21-16-5-4-13(22(24)25)8-15(16)20/h1-8,10H,9H2,(H,21,23) |
| InChIKey | ZKONIRDNVRZOAE-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.28 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|