C19H13F3N2O4S — CID 19497034
4-[(4-nitrophenoxy)methyl]-N-[2-(trifluoromethyl)phenyl]thiophene-2-carboxamide (PubChem CID 19497034) has the molecular formula C19H13F3N2O4S and a molecular weight of 422.38 g/mol. Its IUPAC name is 4-[(4-nitrophenoxy)methyl]-N-[2-(trifluoromethyl)phenyl]thiophene-2-carboxamide.
| Compound Name | 4-[(4-nitrophenoxy)methyl]-N-[2-(trifluoromethyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19497034 |
| Molecular Formula | C19H13F3N2O4S |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | 4-[(4-nitrophenoxy)methyl]-N-[2-(trifluoromethyl)phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)c1cc(COc2ccc([N+](=O)[O-])cc2)cs1 |
| InChI | InChI=1S/C19H13F3N2O4S/c20-19(21,22)15-3-1-2-4-16(15)23-18(25)17-9-12(11-29-17)10-28-14-7-5-13(6-8-14)24(26)27/h1-9,11H,10H2,(H,23,25) |
| InChIKey | NWUHYJIZCVALSC-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|