C18H12BrClFNO2S — CID 19503044
N-(4-bromo-2-fluorophenyl)-4-[(2-chlorophenoxy)methyl]thiophene-2-carboxamide (PubChem CID 19503044) has the molecular formula C18H12BrClFNO2S and a molecular weight of 440.72 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-4-[(2-chlorophenoxy)methyl]thiophene-2-carboxamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-4-[(2-chlorophenoxy)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19503044 |
| Molecular Formula | C18H12BrClFNO2S |
| Molecular Weight | 440.72 g/mol |
| Exact Mass | 438.94 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-4-[(2-chlorophenoxy)methyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1F)c1cc(COc2ccccc2Cl)cs1 |
| InChI | InChI=1S/C18H12BrClFNO2S/c19-12-5-6-15(14(21)8-12)22-18(23)17-7-11(10-25-17)9-24-16-4-2-1-3-13(16)20/h1-8,10H,9H2,(H,22,23) |
| InChIKey | PMHBAYJAFAXBFT-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.72 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |