C17H14ClNO3S — CID 19503099
4-[(2-chlorophenoxy)methyl]-N-(furan-2-ylmethyl)thiophene-2-carboxamide (PubChem CID 19503099) has the molecular formula C17H14ClNO3S and a molecular weight of 347.82 g/mol. Its IUPAC name is 4-[(2-chlorophenoxy)methyl]-N-(furan-2-ylmethyl)thiophene-2-carboxamide.
| Compound Name | 4-[(2-chlorophenoxy)methyl]-N-(furan-2-ylmethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19503099 |
| Molecular Formula | C17H14ClNO3S |
| Molecular Weight | 347.82 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 4-[(2-chlorophenoxy)methyl]-N-(furan-2-ylmethyl)thiophene-2-carboxamide |
| SMILES | O=C(NCc1ccco1)c1cc(COc2ccccc2Cl)cs1 |
| InChI | InChI=1S/C17H14ClNO3S/c18-14-5-1-2-6-15(14)22-10-12-8-16(23-11-12)17(20)19-9-13-4-3-7-21-13/h1-8,11H,9-10H2,(H,19,20) |
| InChIKey | JIZMJZWRWBLBKU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.82 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |