C18H17NO4S — CID 19500932
N-(furan-2-ylmethyl)-4-[(3-methoxyphenoxy)methyl]thiophene-2-carboxamide (PubChem CID 19500932) has the molecular formula C18H17NO4S and a molecular weight of 343.40 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-[(3-methoxyphenoxy)methyl]thiophene-2-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-4-[(3-methoxyphenoxy)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19500932 |
| Molecular Formula | C18H17NO4S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-[(3-methoxyphenoxy)methyl]thiophene-2-carboxamide |
| SMILES | COc1cccc(OCc2csc(C(=O)NCc3ccco3)c2)c1 |
| InChI | InChI=1S/C18H17NO4S/c1-21-14-4-2-5-15(9-14)23-11-13-8-17(24-12-13)18(20)19-10-16-6-3-7-22-16/h2-9,12H,10-11H2,1H3,(H,19,20) |
| InChIKey | BDOONOJUAYKAOU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |