C19H15Cl2NO3S — CID 19503027
N-(3-chloro-4-methoxyphenyl)-4-[(2-chlorophenoxy)methyl]thiophene-2-carboxamide (PubChem CID 19503027) has the molecular formula C19H15Cl2NO3S and a molecular weight of 408.31 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-4-[(2-chlorophenoxy)methyl]thiophene-2-carboxamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-4-[(2-chlorophenoxy)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19503027 |
| Molecular Formula | C19H15Cl2NO3S |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-4-[(2-chlorophenoxy)methyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc(COc3ccccc3Cl)cs2)cc1Cl |
| InChI | InChI=1S/C19H15Cl2NO3S/c1-24-16-7-6-13(9-15(16)21)22-19(23)18-8-12(11-26-18)10-25-17-5-3-2-4-14(17)20/h2-9,11H,10H2,1H3,(H,22,23) |
| InChIKey | CGRDMEILNPXADK-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |