C22H22ClNO3S — CID 19484551
N-(3-chloro-4-methoxyphenyl)-4-[(4-propan-2-ylphenoxy)methyl]thiophene-2-carboxamide (PubChem CID 19484551) has the molecular formula C22H22ClNO3S and a molecular weight of 415.94 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-4-[(4-propan-2-ylphenoxy)methyl]thiophene-2-carboxamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-4-[(4-propan-2-ylphenoxy)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19484551 |
| Molecular Formula | C22H22ClNO3S |
| Molecular Weight | 415.94 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-4-[(4-propan-2-ylphenoxy)methyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc(COc3ccc(C(C)C)cc3)cs2)cc1Cl |
| InChI | InChI=1S/C22H22ClNO3S/c1-14(2)16-4-7-18(8-5-16)27-12-15-10-21(28-13-15)22(25)24-17-6-9-20(26-3)19(23)11-17/h4-11,13-14H,12H2,1-3H3,(H,24,25) |
| InChIKey | RUZDASUSUANYJL-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.94 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |