C23H25NO3S — CID 19484576
N-(2-methoxy-5-methylphenyl)-4-[(4-propan-2-ylphenoxy)methyl]thiophene-2-carboxamide (PubChem CID 19484576) has the molecular formula C23H25NO3S and a molecular weight of 395.52 g/mol. Its IUPAC name is N-(2-methoxy-5-methylphenyl)-4-[(4-propan-2-ylphenoxy)methyl]thiophene-2-carboxamide.
| Compound Name | N-(2-methoxy-5-methylphenyl)-4-[(4-propan-2-ylphenoxy)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19484576 |
| Molecular Formula | C23H25NO3S |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | N-(2-methoxy-5-methylphenyl)-4-[(4-propan-2-ylphenoxy)methyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(C)cc1NC(=O)c1cc(COc2ccc(C(C)C)cc2)cs1 |
| InChI | InChI=1S/C23H25NO3S/c1-15(2)18-6-8-19(9-7-18)27-13-17-12-22(28-14-17)23(25)24-20-11-16(3)5-10-21(20)26-4/h5-12,14-15H,13H2,1-4H3,(H,24,25) |
| InChIKey | MATAFGFUZQCEOF-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |