C22H22FNO2S — CID 19484549
N-[(4-fluorophenyl)methyl]-4-[(4-propan-2-ylphenoxy)methyl]thiophene-2-carboxamide (PubChem CID 19484549) has the molecular formula C22H22FNO2S and a molecular weight of 383.49 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-4-[(4-propan-2-ylphenoxy)methyl]thiophene-2-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-4-[(4-propan-2-ylphenoxy)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19484549 |
| Molecular Formula | C22H22FNO2S |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-4-[(4-propan-2-ylphenoxy)methyl]thiophene-2-carboxamide |
| SMILES | CC(C)c1ccc(OCc2csc(C(=O)NCc3ccc(F)cc3)c2)cc1 |
| InChI | InChI=1S/C22H22FNO2S/c1-15(2)18-5-9-20(10-6-18)26-13-17-11-21(27-14-17)22(25)24-12-16-3-7-19(23)8-4-16/h3-11,14-15H,12-13H2,1-2H3,(H,24,25) |
| InChIKey | PGJGVVVPUWCHHZ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |