C18H18N4O4S — CID 19501098
N-(1-ethyl-3-methylpyrazol-4-yl)-4-[(2-nitrophenoxy)methyl]thiophene-2-carboxamide (PubChem CID 19501098) has the molecular formula C18H18N4O4S and a molecular weight of 386.43 g/mol. Its IUPAC name is N-(1-ethyl-3-methylpyrazol-4-yl)-4-[(2-nitrophenoxy)methyl]thiophene-2-carboxamide.
| Compound Name | N-(1-ethyl-3-methylpyrazol-4-yl)-4-[(2-nitrophenoxy)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19501098 |
| Molecular Formula | C18H18N4O4S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | N-(1-ethyl-3-methylpyrazol-4-yl)-4-[(2-nitrophenoxy)methyl]thiophene-2-carboxamide |
| SMILES | CCn1cc(NC(=O)c2cc(COc3ccccc3[N+](=O)[O-])cs2)c(C)n1 |
| InChI | InChI=1S/C18H18N4O4S/c1-3-21-9-14(12(2)20-21)19-18(23)17-8-13(11-27-17)10-26-16-7-5-4-6-15(16)22(24)25/h4-9,11H,3,10H2,1-2H3,(H,19,23) |
| InChIKey | SNTJNNZXUZZUQR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|