C18H21ClFN5O4 — CID 19536100
1-[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-2-(3-methoxy-4-nitropyrazol-1-yl)propan-1-one (PubChem CID 19536100) has the molecular formula C18H21ClFN5O4 and a molecular weight of 425.85 g/mol. Its IUPAC name is 1-[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-2-(3-methoxy-4-nitropyrazol-1-yl)propan-1-one.
| Compound Name | 1-[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-2-(3-methoxy-4-nitropyrazol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 19536100 |
| Molecular Formula | C18H21ClFN5O4 |
| Molecular Weight | 425.85 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 1-[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-2-(3-methoxy-4-nitropyrazol-1-yl)propan-1-one |
| SMILES | COc1nn(C(C)C(=O)N2CCN(Cc3ccc(F)cc3Cl)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H21ClFN5O4/c1-12(24-11-16(25(27)28)17(21-24)29-2)18(26)23-7-5-22(6-8-23)10-13-3-4-14(20)9-15(13)19/h3-4,9,11-12H,5-8,10H2,1-2H3 |
| InChIKey | DQFRUHDRQYWSQS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 93.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.85 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|