C15H21N7O6S — CID 19536119
2-(3-methoxy-4-nitropyrazol-1-yl)-1-[4-(1-methylpyrazol-4-yl)sulfonylpiperazin-1-yl]propan-1-one (PubChem CID 19536119) has the molecular formula C15H21N7O6S and a molecular weight of 427.44 g/mol. Its IUPAC name is 2-(3-methoxy-4-nitropyrazol-1-yl)-1-[4-(1-methylpyrazol-4-yl)sulfonylpiperazin-1-yl]propan-1-one.
| Compound Name | 2-(3-methoxy-4-nitropyrazol-1-yl)-1-[4-(1-methylpyrazol-4-yl)sulfonylpiperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 19536119 |
| Molecular Formula | C15H21N7O6S |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 2-(3-methoxy-4-nitropyrazol-1-yl)-1-[4-(1-methylpyrazol-4-yl)sulfonylpiperazin-1-yl]propan-1-one |
| SMILES | COc1nn(C(C)C(=O)N2CCN(S(=O)(=O)c3cnn(C)c3)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H21N7O6S/c1-11(21-10-13(22(24)25)14(17-21)28-3)15(23)19-4-6-20(7-5-19)29(26,27)12-8-16-18(2)9-12/h8-11H,4-7H2,1-3H3 |
| InChIKey | BFGYDUDEGFRREL-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 145.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|