C16H23N7O5S — CID 19536170
1-[4-(1-ethyl-3-methylpyrazol-4-yl)sulfonylpiperazin-1-yl]-2-(4-nitropyrazol-1-yl)propan-1-one (PubChem CID 19536170) has the molecular formula C16H23N7O5S and a molecular weight of 425.47 g/mol. Its IUPAC name is 1-[4-(1-ethyl-3-methylpyrazol-4-yl)sulfonylpiperazin-1-yl]-2-(4-nitropyrazol-1-yl)propan-1-one.
| Compound Name | 1-[4-(1-ethyl-3-methylpyrazol-4-yl)sulfonylpiperazin-1-yl]-2-(4-nitropyrazol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 19536170 |
| Molecular Formula | C16H23N7O5S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 1-[4-(1-ethyl-3-methylpyrazol-4-yl)sulfonylpiperazin-1-yl]-2-(4-nitropyrazol-1-yl)propan-1-one |
| SMILES | CCn1cc(S(=O)(=O)N2CCN(C(=O)C(C)n3cc([N+](=O)[O-])cn3)CC2)c(C)n1 |
| InChI | InChI=1S/C16H23N7O5S/c1-4-20-11-15(12(2)18-20)29(27,28)21-7-5-19(6-8-21)16(24)13(3)22-10-14(9-17-22)23(25)26/h9-11,13H,4-8H2,1-3H3 |
| InChIKey | FRYXCQRYJNRMRJ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 136.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|