C16H23N7O3 — CID 19536164
1-[4-[(1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]-2-(4-nitropyrazol-1-yl)propan-1-one (PubChem CID 19536164) has the molecular formula C16H23N7O3 and a molecular weight of 361.41 g/mol. Its IUPAC name is 1-[4-[(1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]-2-(4-nitropyrazol-1-yl)propan-1-one.
| Compound Name | 1-[4-[(1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]-2-(4-nitropyrazol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 19536164 |
| Molecular Formula | C16H23N7O3 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 1-[4-[(1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]-2-(4-nitropyrazol-1-yl)propan-1-one |
| SMILES | Cc1nn(C)cc1CN1CCN(C(=O)C(C)n2cc([N+](=O)[O-])cn2)CC1 |
| InChI | InChI=1S/C16H23N7O3/c1-12-14(9-19(3)18-12)10-20-4-6-21(7-5-20)16(24)13(2)22-11-15(8-17-22)23(25)26/h8-9,11,13H,4-7,10H2,1-3H3 |
| InChIKey | ZHDRSHTWUIJRPV-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 102.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|