C17H20ClN5O3 — CID 19333865
(4-chloro-3-nitrophenyl)-[4-[(1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]methanone (PubChem CID 19333865) has the molecular formula C17H20ClN5O3 and a molecular weight of 377.83 g/mol. Its IUPAC name is (4-chloro-3-nitrophenyl)-[4-[(1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]methanone.
| Compound Name | (4-chloro-3-nitrophenyl)-[4-[(1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 19333865 |
| Molecular Formula | C17H20ClN5O3 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | (4-chloro-3-nitrophenyl)-[4-[(1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]methanone |
| SMILES | Cc1nn(C)cc1CN1CCN(C(=O)c2ccc(Cl)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C17H20ClN5O3/c1-12-14(10-20(2)19-12)11-21-5-7-22(8-6-21)17(24)13-3-4-15(18)16(9-13)23(25)26/h3-4,9-10H,5-8,11H2,1-2H3 |
| InChIKey | XURICUYMVYCQAB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|