C21H21ClN4O6 — CID 29199905
N-[2-[4-(4-chloro-3-nitrobenzoyl)piperazin-1-yl]ethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 29199905) has the molecular formula C21H21ClN4O6 and a molecular weight of 460.87 g/mol. Its IUPAC name is N-[2-[4-(4-chloro-3-nitrobenzoyl)piperazin-1-yl]ethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-[4-(4-chloro-3-nitrobenzoyl)piperazin-1-yl]ethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 29199905 |
| Molecular Formula | C21H21ClN4O6 |
| Molecular Weight | 460.87 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | N-[2-[4-(4-chloro-3-nitrobenzoyl)piperazin-1-yl]ethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NCCN1CCN(C(=O)c2ccc(Cl)c([N+](=O)[O-])c2)CC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H21ClN4O6/c22-16-3-1-15(11-17(16)26(29)30)21(28)25-9-7-24(8-10-25)6-5-23-20(27)14-2-4-18-19(12-14)32-13-31-18/h1-4,11-12H,5-10,13H2,(H,23,27) |
| InChIKey | ZHOYAQSNDQHJTK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.87 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|