C18H22ClN5O3 — CID 19572373
(4-chloro-3-nitrophenyl)-[4-[(1-ethyl-3-methylpyrazol-4-yl)methyl]piperazin-1-yl]methanone (PubChem CID 19572373) has the molecular formula C18H22ClN5O3 and a molecular weight of 391.86 g/mol. Its IUPAC name is (4-chloro-3-nitrophenyl)-[4-[(1-ethyl-3-methylpyrazol-4-yl)methyl]piperazin-1-yl]methanone.
| Compound Name | (4-chloro-3-nitrophenyl)-[4-[(1-ethyl-3-methylpyrazol-4-yl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 19572373 |
| Molecular Formula | C18H22ClN5O3 |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | (4-chloro-3-nitrophenyl)-[4-[(1-ethyl-3-methylpyrazol-4-yl)methyl]piperazin-1-yl]methanone |
| SMILES | CCn1cc(CN2CCN(C(=O)c3ccc(Cl)c([N+](=O)[O-])c3)CC2)c(C)n1 |
| InChI | InChI=1S/C18H22ClN5O3/c1-3-23-12-15(13(2)20-23)11-21-6-8-22(9-7-21)18(25)14-4-5-16(19)17(10-14)24(26)27/h4-5,10,12H,3,6-9,11H2,1-2H3 |
| InChIKey | RTCLZQWMWSWDAU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|