C24H31N7O3 — CID 19333956
[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-[4-[(1-ethyl-3-methylpyrazol-4-yl)methyl]piperazin-1-yl]methanone (PubChem CID 19333956) has the molecular formula C24H31N7O3 and a molecular weight of 465.56 g/mol. Its IUPAC name is [3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-[4-[(1-ethyl-3-methylpyrazol-4-yl)methyl]piperazin-1-yl]methanone.
| Compound Name | [3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-[4-[(1-ethyl-3-methylpyrazol-4-yl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 19333956 |
| Molecular Formula | C24H31N7O3 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | [3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-[4-[(1-ethyl-3-methylpyrazol-4-yl)methyl]piperazin-1-yl]methanone |
| SMILES | CCn1cc(CN2CCN(C(=O)c3cccc(Cn4nc(C)c([N+](=O)[O-])c4C)c3)CC2)c(C)n1 |
| InChI | InChI=1S/C24H31N7O3/c1-5-29-16-22(17(2)25-29)15-27-9-11-28(12-10-27)24(32)21-8-6-7-20(13-21)14-30-19(4)23(31(33)34)18(3)26-30/h6-8,13,16H,5,9-12,14-15H2,1-4H3 |
| InChIKey | IZRLPTXMWMJSGQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 102.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|