C23H29N7O3 — CID 19333737
[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-[4-[(1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]methanone (PubChem CID 19333737) has the molecular formula C23H29N7O3 and a molecular weight of 451.53 g/mol. Its IUPAC name is [3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-[4-[(1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]methanone.
| Compound Name | [3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-[4-[(1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 19333737 |
| Molecular Formula | C23H29N7O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | [3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-[4-[(1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]methanone |
| SMILES | Cc1nn(C)cc1CN1CCN(C(=O)c2cccc(Cn3nc(C)c([N+](=O)[O-])c3C)c2)CC1 |
| InChI | InChI=1S/C23H29N7O3/c1-16-21(14-26(4)24-16)15-27-8-10-28(11-9-27)23(31)20-7-5-6-19(12-20)13-29-18(3)22(30(32)33)17(2)25-29/h5-7,12,14H,8-11,13,15H2,1-4H3 |
| InChIKey | SZLZODYXDSHVTE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 102.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|