C23H27N5O5 — CID 19333707
[4-[(1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]-[5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-yl]methanone (PubChem CID 19333707) has the molecular formula C23H27N5O5 and a molecular weight of 453.50 g/mol. Its IUPAC name is [4-[(1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]-[5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-yl]methanone.
| Compound Name | [4-[(1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]-[5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-yl]methanone |
|---|---|
| PubChem CID | 19333707 |
| Molecular Formula | C23H27N5O5 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | [4-[(1,3-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]-[5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-yl]methanone |
| SMILES | Cc1ccc(OCc2ccc(C(=O)N3CCN(Cc4cn(C)nc4C)CC3)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H27N5O5/c1-16-4-6-21(20(12-16)28(30)31)32-15-19-5-7-22(33-19)23(29)27-10-8-26(9-11-27)14-18-13-25(3)24-17(18)2/h4-7,12-13H,8-11,14-15H2,1-3H3 |
| InChIKey | AKMKMFILBIOGTI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 106.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|