C13H12N2O5 — CID 580014
5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-carboxamide (PubChem CID 580014) has the molecular formula C13H12N2O5 and a molecular weight of 276.25 g/mol. Its IUPAC name is 5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-carboxamide.
| Compound Name | 5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 580014 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-carboxamide |
| SMILES | Cc1ccc(OCc2ccc(C(N)=O)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H12N2O5/c1-8-2-4-11(10(6-8)15(17)18)19-7-9-3-5-12(20-9)13(14)16/h2-6H,7H2,1H3,(H2,14,16) |
| InChIKey | UINJUSVKGWHJSP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 108.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|