C22H22N2O7S — CID 19461264
ethyl 4,5-dimethyl-2-[[5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-carbonyl]amino]thiophene-3-carboxylate (PubChem CID 19461264) has the molecular formula C22H22N2O7S and a molecular weight of 458.49 g/mol. Its IUPAC name is ethyl 4,5-dimethyl-2-[[5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-carbonyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4,5-dimethyl-2-[[5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-carbonyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19461264 |
| Molecular Formula | C22H22N2O7S |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | ethyl 4,5-dimethyl-2-[[5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-carbonyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccc(COc3ccc(C)cc3[N+](=O)[O-])o2)sc(C)c1C |
| InChI | InChI=1S/C22H22N2O7S/c1-5-29-22(26)19-13(3)14(4)32-21(19)23-20(25)18-9-7-15(31-18)11-30-17-8-6-12(2)10-16(17)24(27)28/h6-10H,5,11H2,1-4H3,(H,23,25) |
| InChIKey | NRWQCWSZAAZWCI-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|