C21H20N2O5 — CID 19461245
5-[(4-methyl-2-nitrophenoxy)methyl]-N-(1-phenylethyl)furan-2-carboxamide (PubChem CID 19461245) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is 5-[(4-methyl-2-nitrophenoxy)methyl]-N-(1-phenylethyl)furan-2-carboxamide.
| Compound Name | 5-[(4-methyl-2-nitrophenoxy)methyl]-N-(1-phenylethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19461245 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 5-[(4-methyl-2-nitrophenoxy)methyl]-N-(1-phenylethyl)furan-2-carboxamide |
| SMILES | Cc1ccc(OCc2ccc(C(=O)NC(C)c3ccccc3)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H20N2O5/c1-14-8-10-19(18(12-14)23(25)26)27-13-17-9-11-20(28-17)21(24)22-15(2)16-6-4-3-5-7-16/h3-12,15H,13H2,1-2H3,(H,22,24) |
| InChIKey | TUKLDAWXWGGKAJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 94.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|