C20H17FN2O5 — CID 19461206
N-[(4-fluorophenyl)methyl]-5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-carboxamide (PubChem CID 19461206) has the molecular formula C20H17FN2O5 and a molecular weight of 384.36 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19461206 |
| Molecular Formula | C20H17FN2O5 |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-carboxamide |
| SMILES | Cc1ccc(OCc2ccc(C(=O)NCc3ccc(F)cc3)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H17FN2O5/c1-13-2-8-18(17(10-13)23(25)26)27-12-16-7-9-19(28-16)20(24)22-11-14-3-5-15(21)6-4-14/h2-10H,11-12H2,1H3,(H,22,24) |
| InChIKey | ITDKCCPEEQCSBR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 94.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|