C12H8N2O8 — CID 4681812
5-[(2,4-dinitrophenoxy)methyl]furan-2-carboxylic acid (PubChem CID 4681812) has the molecular formula C12H8N2O8 and a molecular weight of 308.20 g/mol. Its IUPAC name is 5-[(2,4-dinitrophenoxy)methyl]furan-2-carboxylic acid.
| Compound Name | 5-[(2,4-dinitrophenoxy)methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 4681812 |
| Molecular Formula | C12H8N2O8 |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 5-[(2,4-dinitrophenoxy)methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(COc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C12H8N2O8/c15-12(16)11-4-2-8(22-11)6-21-10-3-1-7(13(17)18)5-9(10)14(19)20/h1-5H,6H2,(H,15,16) |
| InChIKey | PZYAGVKZVVDHFU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 145.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|