C18H15F4N3O6 — CID 4748396
[3,5-bis(difluoromethyl)-3-hydroxy-1H-pyrazol-2-yl]-[5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-yl]methanone (PubChem CID 4748396) has the molecular formula C18H15F4N3O6 and a molecular weight of 445.33 g/mol. Its IUPAC name is [3,5-bis(difluoromethyl)-3-hydroxy-1H-pyrazol-2-yl]-[5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-yl]methanone.
| Compound Name | [3,5-bis(difluoromethyl)-3-hydroxy-1H-pyrazol-2-yl]-[5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-yl]methanone |
|---|---|
| PubChem CID | 4748396 |
| Molecular Formula | C18H15F4N3O6 |
| Molecular Weight | 445.33 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | [3,5-bis(difluoromethyl)-3-hydroxy-1H-pyrazol-2-yl]-[5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-yl]methanone |
| SMILES | Cc1ccc(OCc2ccc(C(=O)N3NC(C(F)F)=CC3(O)C(F)F)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H15F4N3O6/c1-9-2-4-13(12(6-9)25(28)29)30-8-10-3-5-14(31-10)16(26)24-18(27,17(21)22)7-11(23-24)15(19)20/h2-7,15,17,23,27H,8H2,1H3 |
| InChIKey | ANAGFZHUBIDDIB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|