C14H14ClN5O3S — CID 108729477
(4-chloro-3-nitrophenyl)-[4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]methanone (PubChem CID 108729477) has the molecular formula C14H14ClN5O3S and a molecular weight of 367.82 g/mol. Its IUPAC name is (4-chloro-3-nitrophenyl)-[4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]methanone.
| Compound Name | (4-chloro-3-nitrophenyl)-[4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 108729477 |
| Molecular Formula | C14H14ClN5O3S |
| Molecular Weight | 367.82 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | (4-chloro-3-nitrophenyl)-[4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]methanone |
| SMILES | Cc1nnc(N2CCN(C(=O)c3ccc(Cl)c([N+](=O)[O-])c3)CC2)s1 |
| InChI | InChI=1S/C14H14ClN5O3S/c1-9-16-17-14(24-9)19-6-4-18(5-7-19)13(21)10-2-3-11(15)12(8-10)20(22)23/h2-3,8H,4-7H2,1H3 |
| InChIKey | DJYQQPVLMWIIFT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 92.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.82 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|